C13H17Cl2NO2 — CID 11630672
9-benzyl-1-chloro-3,7-dioxa-9-azabicyclo[3.3.1]nonane;hydrochloride (PubChem CID 11630672) has the molecular formula C13H17Cl2NO2 and a molecular weight of 290.19 g/mol. Its IUPAC name is 9-benzyl-1-chloro-3,7-dioxa-9-azabicyclo[3.3.1]nonane;hydrochloride.
| Compound Name | 9-benzyl-1-chloro-3,7-dioxa-9-azabicyclo[3.3.1]nonane;hydrochloride |
|---|---|
| PubChem CID | 11630672 |
| Molecular Formula | C13H17Cl2NO2 |
| Molecular Weight | 290.19 g/mol |
| Exact Mass | 289.06 |
| IUPAC Name | 9-benzyl-1-chloro-3,7-dioxa-9-azabicyclo[3.3.1]nonane;hydrochloride |
| SMILES | Cl.ClC12COCC(COC1)N2Cc1ccccc1 |
| InChI | InChI=1S/C13H16ClNO2.ClH/c14-13-9-16-7-12(8-17-10-13)15(13)6-11-4-2-1-3-5-11;/h1-5,12H,6-10H2;1H |
| InChIKey | NSXYARGOFZMRBG-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.19 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|