C16H14F2N4O3S — CID 11632320
2,4-difluoro-N-[2-[[4-(furan-2-yl)pyrimidin-2-yl]amino]ethyl]benzenesulfonamide (PubChem CID 11632320) has the molecular formula C16H14F2N4O3S and a molecular weight of 380.38 g/mol. Its IUPAC name is 2,4-difluoro-N-[2-[[4-(furan-2-yl)pyrimidin-2-yl]amino]ethyl]benzenesulfonamide.
| Compound Name | 2,4-difluoro-N-[2-[[4-(furan-2-yl)pyrimidin-2-yl]amino]ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 11632320 |
| Molecular Formula | C16H14F2N4O3S |
| Molecular Weight | 380.38 g/mol |
| Exact Mass | 380.08 |
| IUPAC Name | 2,4-difluoro-N-[2-[[4-(furan-2-yl)pyrimidin-2-yl]amino]ethyl]benzenesulfonamide |
| SMILES | O=S(=O)(NCCNc1nccc(-c2ccco2)n1)c1ccc(F)cc1F |
| InChI | InChI=1S/C16H14F2N4O3S/c17-11-3-4-15(12(18)10-11)26(23,24)21-8-7-20-16-19-6-5-13(22-16)14-2-1-9-25-14/h1-6,9-10,21H,7-8H2,(H,19,20,22) |
| InChIKey | QVVJMKOSRDWLEM-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 97.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.38 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|