C26H27NO3 — CID 11632745
1-[3-hydroxy-3-(3-methoxyphenyl)piperidin-1-yl]-2,2-diphenylethanone (PubChem CID 11632745) has the molecular formula C26H27NO3 and a molecular weight of 401.51 g/mol. Its IUPAC name is 1-[3-hydroxy-3-(3-methoxyphenyl)piperidin-1-yl]-2,2-diphenylethanone.
| Compound Name | 1-[3-hydroxy-3-(3-methoxyphenyl)piperidin-1-yl]-2,2-diphenylethanone |
|---|---|
| PubChem CID | 11632745 |
| Molecular Formula | C26H27NO3 |
| Molecular Weight | 401.51 g/mol |
| Exact Mass | 401.20 |
| IUPAC Name | 1-[3-hydroxy-3-(3-methoxyphenyl)piperidin-1-yl]-2,2-diphenylethanone |
| SMILES | COc1cccc(C2(O)CCCN(C(=O)C(c3ccccc3)c3ccccc3)C2)c1 |
| InChI | InChI=1S/C26H27NO3/c1-30-23-15-8-14-22(18-23)26(29)16-9-17-27(19-26)25(28)24(20-10-4-2-5-11-20)21-12-6-3-7-13-21/h2-8,10-15,18,24,29H,9,16-17,19H2,1H3 |
| InChIKey | YCUDSPSEJCELMT-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.51 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |