C30H42F3N5O2 — CID 11635438
N-hexyl-2-[4-[5-(hexylamino)-2-(trifluoromethyl)benzoyl]piperazin-1-yl]pyridine-4-carboxamide (PubChem CID 11635438) has the molecular formula C30H42F3N5O2 and a molecular weight of 561.69 g/mol. Its IUPAC name is N-hexyl-2-[4-[5-(hexylamino)-2-(trifluoromethyl)benzoyl]piperazin-1-yl]pyridine-4-carboxamide.
| Compound Name | N-hexyl-2-[4-[5-(hexylamino)-2-(trifluoromethyl)benzoyl]piperazin-1-yl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 11635438 |
| Molecular Formula | C30H42F3N5O2 |
| Molecular Weight | 561.69 g/mol |
| Exact Mass | 561.33 |
| IUPAC Name | N-hexyl-2-[4-[5-(hexylamino)-2-(trifluoromethyl)benzoyl]piperazin-1-yl]pyridine-4-carboxamide |
| SMILES | CCCCCCNC(=O)c1ccnc(N2CCN(C(=O)c3cc(NCCCCCC)ccc3C(F)(F)F)CC2)c1 |
| InChI | InChI=1S/C30H42F3N5O2/c1-3-5-7-9-14-34-24-11-12-26(30(31,32)33)25(22-24)29(40)38-19-17-37(18-20-38)27-21-23(13-16-35-27)28(39)36-15-10-8-6-4-2/h11-13,16,21-22,34H,3-10,14-15,17-20H2,1-2H3,(H,36,39) |
| InChIKey | UMBGSUJPSPGPHI-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 77.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.69 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|