C30H33ClF2N6O3 — CID 11635731
5-chloro-6-[4-[1-[(3,4-difluorophenyl)methyl]piperidin-4-yl]piperazin-1-yl]-N-[1-(4-nitrophenyl)ethyl]pyridine-3-carboxamide (PubChem CID 11635731) has the molecular formula C30H33ClF2N6O3 and a molecular weight of 599.08 g/mol. Its IUPAC name is 5-chloro-6-[4-[1-[(3,4-difluorophenyl)methyl]piperidin-4-yl]piperazin-1-yl]-N-[1-(4-nitrophenyl)ethyl]pyridine-3-carboxamide.
| Compound Name | 5-chloro-6-[4-[1-[(3,4-difluorophenyl)methyl]piperidin-4-yl]piperazin-1-yl]-N-[1-(4-nitrophenyl)ethyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 11635731 |
| Molecular Formula | C30H33ClF2N6O3 |
| Molecular Weight | 599.08 g/mol |
| Exact Mass | 598.23 |
| IUPAC Name | 5-chloro-6-[4-[1-[(3,4-difluorophenyl)methyl]piperidin-4-yl]piperazin-1-yl]-N-[1-(4-nitrophenyl)ethyl]pyridine-3-carboxamide |
| SMILES | CC(NC(=O)c1cnc(N2CCN(C3CCN(Cc4ccc(F)c(F)c4)CC3)CC2)c(Cl)c1)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C30H33ClF2N6O3/c1-20(22-3-5-25(6-4-22)39(41)42)35-30(40)23-17-26(31)29(34-18-23)38-14-12-37(13-15-38)24-8-10-36(11-9-24)19-21-2-7-27(32)28(33)16-21/h2-7,16-18,20,24H,8-15,19H2,1H3,(H,35,40) |
| InChIKey | WPQHVHJFMYWPAY-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 94.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.08 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|