C7HF13 — CID 11636522
1,1,1,3,5,5,5-heptafluoro-2,4-bis(trifluoromethyl)pent-2-ene (PubChem CID 11636522) has the molecular formula C7HF13 and a molecular weight of 332.06 g/mol. Its IUPAC name is 1,1,1,3,5,5,5-heptafluoro-2,4-bis(trifluoromethyl)pent-2-ene.
| Compound Name | 1,1,1,3,5,5,5-heptafluoro-2,4-bis(trifluoromethyl)pent-2-ene |
|---|---|
| PubChem CID | 11636522 |
| Molecular Formula | C7HF13 |
| Molecular Weight | 332.06 g/mol |
| Exact Mass | 331.99 |
| IUPAC Name | 1,1,1,3,5,5,5-heptafluoro-2,4-bis(trifluoromethyl)pent-2-ene |
| SMILES | FC(=C(C(F)(F)F)C(F)(F)F)C(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C7HF13/c8-1(2(4(9,10)11)5(12,13)14)3(6(15,16)17)7(18,19)20/h2H |
| InChIKey | SWVWFDVLGHFCMT-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.06 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |