C6HF11 — CID 12730203
1,1,1,3,4,5,5,5-octafluoro-2-(trifluoromethyl)pent-2-ene (PubChem CID 12730203) has the molecular formula C6HF11 and a molecular weight of 282.05 g/mol. Its IUPAC name is 1,1,1,3,4,5,5,5-octafluoro-2-(trifluoromethyl)pent-2-ene.
| Compound Name | 1,1,1,3,4,5,5,5-octafluoro-2-(trifluoromethyl)pent-2-ene |
|---|---|
| PubChem CID | 12730203 |
| Molecular Formula | C6HF11 |
| Molecular Weight | 282.05 g/mol |
| Exact Mass | 281.99 |
| IUPAC Name | 1,1,1,3,4,5,5,5-octafluoro-2-(trifluoromethyl)pent-2-ene |
| SMILES | FC(=C(C(F)(F)F)C(F)(F)F)C(F)C(F)(F)F |
| InChI | InChI=1S/C6HF11/c7-1(3(8)6(15,16)17)2(4(9,10)11)5(12,13)14/h3H |
| InChIKey | GLCNLITUOPUHGE-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.05 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |