C7CsF13 — CID 12702819
cesium 1,1,1,3,5,5,5-heptafluoro-2,4-bis(trifluoromethyl)pent-2-ene (PubChem CID 12702819) has the molecular formula C7CsF13 and a molecular weight of 463.96 g/mol. Its IUPAC name is cesium 1,1,1,3,5,5,5-heptafluoro-2,4-bis(trifluoromethyl)pent-2-ene.
| Compound Name | cesium 1,1,1,3,5,5,5-heptafluoro-2,4-bis(trifluoromethyl)pent-2-ene |
|---|---|
| PubChem CID | 12702819 |
| Molecular Formula | C7CsF13 |
| Molecular Weight | 463.96 g/mol |
| Exact Mass | 463.88 |
| IUPAC Name | cesium 1,1,1,3,5,5,5-heptafluoro-2,4-bis(trifluoromethyl)pent-2-ene |
| SMILES | FC(=C(C(F)(F)F)C(F)(F)F)[C-](C(F)(F)F)C(F)(F)F.[Cs+] |
| InChI | InChI=1S/C7F13.Cs/c8-1(2(4(9,10)11)5(12,13)14)3(6(15,16)17)7(18,19)20;/q-1;+1 |
| InChIKey | VRSGYOUHLUZLHP-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.96 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|