C7F12 — CID 12708033
(3Z)-1,1,4,5,5,5-hexafluoro-2,3-bis(trifluoromethyl)penta-1,3-diene (PubChem CID 12708033) has the molecular formula C7F12 and a molecular weight of 312.05 g/mol. Its IUPAC name is (3Z)-1,1,4,5,5,5-hexafluoro-2,3-bis(trifluoromethyl)penta-1,3-diene.
| Compound Name | (3Z)-1,1,4,5,5,5-hexafluoro-2,3-bis(trifluoromethyl)penta-1,3-diene |
|---|---|
| PubChem CID | 12708033 |
| Molecular Formula | C7F12 |
| Molecular Weight | 312.05 g/mol |
| Exact Mass | 311.98 |
| IUPAC Name | (3Z)-1,1,4,5,5,5-hexafluoro-2,3-bis(trifluoromethyl)penta-1,3-diene |
| SMILES | FC(F)=C(/C(=C(/F)C(F)(F)F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C7F12/c8-3(7(17,18)19)1(5(11,12)13)2(4(9)10)6(14,15)16/b3-1- |
| InChIKey | LPXQKGXQHRSWIR-IWQZZHSRSA-N |
| XLogP | 5.05 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.05 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|