C8F14 — CID 10861355
(2Z,4Z)-1,1,1,2,5,6,6,6-octafluoro-3,4-bis(trifluoromethyl)hexa-2,4-diene (PubChem CID 10861355) has the molecular formula C8F14 and a molecular weight of 362.06 g/mol. Its IUPAC name is (2Z,4Z)-1,1,1,2,5,6,6,6-octafluoro-3,4-bis(trifluoromethyl)hexa-2,4-diene.
| Compound Name | (2Z,4Z)-1,1,1,2,5,6,6,6-octafluoro-3,4-bis(trifluoromethyl)hexa-2,4-diene |
|---|---|
| PubChem CID | 10861355 |
| Molecular Formula | C8F14 |
| Molecular Weight | 362.06 g/mol |
| Exact Mass | 361.98 |
| IUPAC Name | (2Z,4Z)-1,1,1,2,5,6,6,6-octafluoro-3,4-bis(trifluoromethyl)hexa-2,4-diene |
| SMILES | F/C(=C(C(=C(/F)C(F)(F)F)/C(F)(F)F)\C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C8F14/c9-3(7(17,18)19)1(5(11,12)13)2(6(14,15)16)4(10)8(20,21)22/b3-1-,4-2- |
| InChIKey | ADIKAOUBGWNCJR-CCAGOZQPSA-N |
| XLogP | 5.68 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.06 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|