C12F20 — CID 12571878
1,1,1,3,5,7,7,7-octafluoro-4-(1,1,1,3,3,3-hexafluoropropan-2-ylidene)-2,6-bis(trifluoromethyl)hepta-2,5-diene (PubChem CID 12571878) has the molecular formula C12F20 and a molecular weight of 524.09 g/mol. Its IUPAC name is 1,1,1,3,5,7,7,7-octafluoro-4-(1,1,1,3,3,3-hexafluoropropan-2-ylidene)-2,6-bis(trifluoromethyl)hepta-2,5-diene.
| Compound Name | 1,1,1,3,5,7,7,7-octafluoro-4-(1,1,1,3,3,3-hexafluoropropan-2-ylidene)-2,6-bis(trifluoromethyl)hepta-2,5-diene |
|---|---|
| PubChem CID | 12571878 |
| Molecular Formula | C12F20 |
| Molecular Weight | 524.09 g/mol |
| Exact Mass | 523.97 |
| IUPAC Name | 1,1,1,3,5,7,7,7-octafluoro-4-(1,1,1,3,3,3-hexafluoropropan-2-ylidene)-2,6-bis(trifluoromethyl)hepta-2,5-diene |
| SMILES | FC(C(C(F)=C(C(F)(F)F)C(F)(F)F)=C(C(F)(F)F)C(F)(F)F)=C(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C12F20/c13-2(5(9(21,22)23)10(24,25)26)1(4(7(15,16)17)8(18,19)20)3(14)6(11(27,28)29)12(30,31)32 |
| InChIKey | LBGNIAIAKXGJNS-UHFFFAOYSA-N |
| XLogP | 8.10 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.09 |
| LogP ≤ 5 | 8.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|