C7H3F7 — CID 12720777
1,2,3,3,4,6,6-heptafluoro-5-methylcyclohexa-1,4-diene (PubChem CID 12720777) has the molecular formula C7H3F7 and a molecular weight of 220.09 g/mol. Its IUPAC name is 1,2,3,3,4,6,6-heptafluoro-5-methylcyclohexa-1,4-diene.
| Compound Name | 1,2,3,3,4,6,6-heptafluoro-5-methylcyclohexa-1,4-diene |
|---|---|
| PubChem CID | 12720777 |
| Molecular Formula | C7H3F7 |
| Molecular Weight | 220.09 g/mol |
| Exact Mass | 220.01 |
| IUPAC Name | 1,2,3,3,4,6,6-heptafluoro-5-methylcyclohexa-1,4-diene |
| SMILES | CC1=C(F)C(F)(F)C(F)=C(F)C1(F)F |
| InChI | InChI=1S/C7H3F7/c1-2-3(8)7(13,14)5(10)4(9)6(2,11)12/h1H3 |
| InChIKey | MESYLWVINUEKDV-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.09 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |