C14H25NO5 — CID 11637814
[(1S,6S,7R,8R,8aR)-1,6,7-trihydroxy-1,2,3,5,6,7,8,8a-octahydroindolizin-8-yl] 2-ethylbutanoate (PubChem CID 11637814) has the molecular formula C14H25NO5 and a molecular weight of 287.36 g/mol. Its IUPAC name is [(1S,6S,7R,8R,8aR)-1,6,7-trihydroxy-1,2,3,5,6,7,8,8a-octahydroindolizin-8-yl] 2-ethylbutanoate.
| Compound Name | [(1S,6S,7R,8R,8aR)-1,6,7-trihydroxy-1,2,3,5,6,7,8,8a-octahydroindolizin-8-yl] 2-ethylbutanoate |
|---|---|
| PubChem CID | 11637814 |
| Molecular Formula | C14H25NO5 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.17 |
| IUPAC Name | [(1S,6S,7R,8R,8aR)-1,6,7-trihydroxy-1,2,3,5,6,7,8,8a-octahydroindolizin-8-yl] 2-ethylbutanoate |
| SMILES | CCC(CC)C(=O)O[C@H]1[C@H](O)[C@@H](O)CN2CC[C@H](O)[C@H]12 |
| InChI | InChI=1S/C14H25NO5/c1-3-8(4-2)14(19)20-13-11-9(16)5-6-15(11)7-10(17)12(13)18/h8-13,16-18H,3-7H2,1-2H3/t9-,10-,11+,12+,13+/m0/s1 |
| InChIKey | GIYZBBVPAMRVTB-KIJLLGNVSA-N |
| XLogP | -0.50 |
| TPSA | 90.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |