C25H27NO4 — CID 11640049
N-[2-[3,4-dimethoxy-5-(4-phenylmethoxyphenyl)phenyl]ethyl]acetamide (PubChem CID 11640049) has the molecular formula C25H27NO4 and a molecular weight of 405.49 g/mol. Its IUPAC name is N-[2-[3,4-dimethoxy-5-(4-phenylmethoxyphenyl)phenyl]ethyl]acetamide.
| Compound Name | N-[2-[3,4-dimethoxy-5-(4-phenylmethoxyphenyl)phenyl]ethyl]acetamide |
|---|---|
| PubChem CID | 11640049 |
| Molecular Formula | C25H27NO4 |
| Molecular Weight | 405.49 g/mol |
| Exact Mass | 405.19 |
| IUPAC Name | N-[2-[3,4-dimethoxy-5-(4-phenylmethoxyphenyl)phenyl]ethyl]acetamide |
| SMILES | COc1cc(CCNC(C)=O)cc(-c2ccc(OCc3ccccc3)cc2)c1OC |
| InChI | InChI=1S/C25H27NO4/c1-18(27)26-14-13-20-15-23(25(29-3)24(16-20)28-2)21-9-11-22(12-10-21)30-17-19-7-5-4-6-8-19/h4-12,15-16H,13-14,17H2,1-3H3,(H,26,27) |
| InChIKey | BOONIOFTDZIXHO-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.49 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |