C7H10N2O6 — CID 11644213
(2R,4S)-4-aminopyrrolidine-1,2,4-tricarboxylic acid (PubChem CID 11644213) has the molecular formula C7H10N2O6 and a molecular weight of 218.16 g/mol. Its IUPAC name is (2R,4S)-4-aminopyrrolidine-1,2,4-tricarboxylic acid.
| Compound Name | (2R,4S)-4-aminopyrrolidine-1,2,4-tricarboxylic acid |
|---|---|
| PubChem CID | 11644213 |
| Molecular Formula | C7H10N2O6 |
| Molecular Weight | 218.16 g/mol |
| Exact Mass | 218.05 |
| IUPAC Name | (2R,4S)-4-aminopyrrolidine-1,2,4-tricarboxylic acid |
| SMILES | N[C@@]1(C(=O)O)C[C@H](C(=O)O)N(C(=O)O)C1 |
| InChI | InChI=1S/C7H10N2O6/c8-7(5(12)13)1-3(4(10)11)9(2-7)6(14)15/h3H,1-2,8H2,(H,10,11)(H,12,13)(H,14,15)/t3-,7+/m1/s1 |
| InChIKey | HTILMSLNKMQINK-NFNCENRGSA-N |
| XLogP | -1.39 |
| TPSA | 141.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.16 |
| LogP ≤ 5 | -1.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |