C11H16N2O7 — CID 11550997
(2R,4S)-4-amino-1-(4-carboxybutanoyl)pyrrolidine-2,4-dicarboxylic acid (PubChem CID 11550997) has the molecular formula C11H16N2O7 and a molecular weight of 288.26 g/mol. Its IUPAC name is (2R,4S)-4-amino-1-(4-carboxybutanoyl)pyrrolidine-2,4-dicarboxylic acid.
| Compound Name | (2R,4S)-4-amino-1-(4-carboxybutanoyl)pyrrolidine-2,4-dicarboxylic acid |
|---|---|
| PubChem CID | 11550997 |
| Molecular Formula | C11H16N2O7 |
| Molecular Weight | 288.26 g/mol |
| Exact Mass | 288.10 |
| IUPAC Name | (2R,4S)-4-amino-1-(4-carboxybutanoyl)pyrrolidine-2,4-dicarboxylic acid |
| SMILES | N[C@@]1(C(=O)O)C[C@H](C(=O)O)N(C(=O)CCCC(=O)O)C1 |
| InChI | InChI=1S/C11H16N2O7/c12-11(10(19)20)4-6(9(17)18)13(5-11)7(14)2-1-3-8(15)16/h6H,1-5,12H2,(H,15,16)(H,17,18)(H,19,20)/t6-,11+/m1/s1 |
| InChIKey | XJZIJZKKGGBDOH-KBUNVGBDSA-N |
| XLogP | -1.29 |
| TPSA | 158.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.26 |
| LogP ≤ 5 | -1.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |