C7H9IN2O5 — CID 70327866
(3R,5S)-3-amino-5-iodo-1-oxalopyrrolidine-3-carboxylic acid (PubChem CID 70327866) has the molecular formula C7H9IN2O5 and a molecular weight of 328.06 g/mol. Its IUPAC name is (3R,5S)-3-amino-5-iodo-1-oxalopyrrolidine-3-carboxylic acid.
| Compound Name | (3R,5S)-3-amino-5-iodo-1-oxalopyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 70327866 |
| Molecular Formula | C7H9IN2O5 |
| Molecular Weight | 328.06 g/mol |
| Exact Mass | 327.96 |
| IUPAC Name | (3R,5S)-3-amino-5-iodo-1-oxalopyrrolidine-3-carboxylic acid |
| SMILES | N[C@]1(C(=O)O)C[C@H](I)N(C(=O)C(=O)O)C1 |
| InChI | InChI=1S/C7H9IN2O5/c8-3-1-7(9,6(14)15)2-10(3)4(11)5(12)13/h3H,1-2,9H2,(H,12,13)(H,14,15)/t3-,7-/m1/s1 |
| InChIKey | HHUOKUSMBMYTLG-WVBDSBKLSA-N |
| XLogP | -1.15 |
| TPSA | 120.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.06 |
| LogP ≤ 5 | -1.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|