C11H17N3O6S — CID 90993334
4-amino-1-[carboxy(propyl)carbamothioyl]pyrrolidine-2,4-dicarboxylic acid (PubChem CID 90993334) has the molecular formula C11H17N3O6S and a molecular weight of 319.34 g/mol. Its IUPAC name is 4-amino-1-[carboxy(propyl)carbamothioyl]pyrrolidine-2,4-dicarboxylic acid.
| Compound Name | 4-amino-1-[carboxy(propyl)carbamothioyl]pyrrolidine-2,4-dicarboxylic acid |
|---|---|
| PubChem CID | 90993334 |
| Molecular Formula | C11H17N3O6S |
| Molecular Weight | 319.34 g/mol |
| Exact Mass | 319.08 |
| IUPAC Name | 4-amino-1-[carboxy(propyl)carbamothioyl]pyrrolidine-2,4-dicarboxylic acid |
| SMILES | CCCN(C(=O)O)C(=S)N1CC(N)(C(=O)O)CC1C(=O)O |
| InChI | InChI=1S/C11H17N3O6S/c1-2-3-13(10(19)20)9(21)14-5-11(12,8(17)18)4-6(14)7(15)16/h6H,2-5,12H2,1H3,(H,15,16)(H,17,18)(H,19,20) |
| InChIKey | CPESXGDFTCJTAS-UHFFFAOYSA-N |
| XLogP | -0.40 |
| TPSA | 144.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.34 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|