C15H19NO2 — CID 11644443
3,4-dimethyl-5-(2,3,3-trimethyl-5-oxocyclopenten-1-yl)-1H-pyrrole-2-carbaldehyde (PubChem CID 11644443) has the molecular formula C15H19NO2 and a molecular weight of 245.32 g/mol. Its IUPAC name is 3,4-dimethyl-5-(2,3,3-trimethyl-5-oxocyclopenten-1-yl)-1H-pyrrole-2-carbaldehyde.
| Compound Name | 3,4-dimethyl-5-(2,3,3-trimethyl-5-oxocyclopenten-1-yl)-1H-pyrrole-2-carbaldehyde |
|---|---|
| PubChem CID | 11644443 |
| Molecular Formula | C15H19NO2 |
| Molecular Weight | 245.32 g/mol |
| Exact Mass | 245.14 |
| IUPAC Name | 3,4-dimethyl-5-(2,3,3-trimethyl-5-oxocyclopenten-1-yl)-1H-pyrrole-2-carbaldehyde |
| SMILES | CC1=C(c2[nH]c(C=O)c(C)c2C)C(=O)CC1(C)C |
| InChI | InChI=1S/C15H19NO2/c1-8-9(2)14(16-11(8)7-17)13-10(3)15(4,5)6-12(13)18/h7,16H,6H2,1-5H3 |
| InChIKey | WYILCXOWQDUKHT-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 49.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.32 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|