C18H30O5 — CID 11645559
1-(10-carboxy-10-methyl-5-oxoundecyl)cyclobutane-1-carboxylic acid (PubChem CID 11645559) has the molecular formula C18H30O5 and a molecular weight of 326.43 g/mol. Its IUPAC name is 1-(10-carboxy-10-methyl-5-oxoundecyl)cyclobutane-1-carboxylic acid.
| Compound Name | 1-(10-carboxy-10-methyl-5-oxoundecyl)cyclobutane-1-carboxylic acid |
|---|---|
| PubChem CID | 11645559 |
| Molecular Formula | C18H30O5 |
| Molecular Weight | 326.43 g/mol |
| Exact Mass | 326.21 |
| IUPAC Name | 1-(10-carboxy-10-methyl-5-oxoundecyl)cyclobutane-1-carboxylic acid |
| SMILES | CC(C)(CCCCC(=O)CCCCC1(C(=O)O)CCC1)C(=O)O |
| InChI | InChI=1S/C18H30O5/c1-17(2,15(20)21)10-5-3-8-14(19)9-4-6-11-18(16(22)23)12-7-13-18/h3-13H2,1-2H3,(H,20,21)(H,22,23) |
| InChIKey | RPGBUFAEKZRJQO-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.43 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|