C29H32N4O5S — CID 11649672
benzyl N-[6-amino-1-oxo-1-[5-[[4-(2-thiophen-2-ylethoxy)phenyl]methyl]-1,2,4-oxadiazol-3-yl]hexan-2-yl]carbamate (PubChem CID 11649672) has the molecular formula C29H32N4O5S and a molecular weight of 548.67 g/mol. Its IUPAC name is benzyl N-[6-amino-1-oxo-1-[5-[[4-(2-thiophen-2-ylethoxy)phenyl]methyl]-1,2,4-oxadiazol-3-yl]hexan-2-yl]carbamate.
| Compound Name | benzyl N-[6-amino-1-oxo-1-[5-[[4-(2-thiophen-2-ylethoxy)phenyl]methyl]-1,2,4-oxadiazol-3-yl]hexan-2-yl]carbamate |
|---|---|
| PubChem CID | 11649672 |
| Molecular Formula | C29H32N4O5S |
| Molecular Weight | 548.67 g/mol |
| Exact Mass | 548.21 |
| IUPAC Name | benzyl N-[6-amino-1-oxo-1-[5-[[4-(2-thiophen-2-ylethoxy)phenyl]methyl]-1,2,4-oxadiazol-3-yl]hexan-2-yl]carbamate |
| SMILES | NCCCCC(NC(=O)OCc1ccccc1)C(=O)c1noc(Cc2ccc(OCCc3cccs3)cc2)n1 |
| InChI | InChI=1S/C29H32N4O5S/c30-16-5-4-10-25(31-29(35)37-20-22-7-2-1-3-8-22)27(34)28-32-26(38-33-28)19-21-11-13-23(14-12-21)36-17-15-24-9-6-18-39-24/h1-3,6-9,11-14,18,25H,4-5,10,15-17,19-20,30H2,(H,31,35) |
| InChIKey | HHDCAIVWDWILBZ-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 129.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.67 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|