C47H45BrO8S — CID 11650814
[4-[(2S,4R,6S)-4-(3-bromo-2,4-dimethoxy-6-phenylmethoxyphenyl)-6-[2-(4-phenylmethoxyphenyl)ethyl]oxan-2-yl]phenyl] benzenesulfonate (PubChem CID 11650814) has the molecular formula C47H45BrO8S and a molecular weight of 849.84 g/mol. Its IUPAC name is [4-[(2S,4R,6S)-4-(3-bromo-2,4-dimethoxy-6-phenylmethoxyphenyl)-6-[2-(4-phenylmethoxyphenyl)ethyl]oxan-2-yl]phenyl] benzenesulfonate.
| Compound Name | [4-[(2S,4R,6S)-4-(3-bromo-2,4-dimethoxy-6-phenylmethoxyphenyl)-6-[2-(4-phenylmethoxyphenyl)ethyl]oxan-2-yl]phenyl] benzenesulfonate |
|---|---|
| PubChem CID | 11650814 |
| Molecular Formula | C47H45BrO8S |
| Molecular Weight | 849.84 g/mol |
| Exact Mass | 848.20 |
| IUPAC Name | [4-[(2S,4R,6S)-4-(3-bromo-2,4-dimethoxy-6-phenylmethoxyphenyl)-6-[2-(4-phenylmethoxyphenyl)ethyl]oxan-2-yl]phenyl] benzenesulfonate |
| SMILES | COc1cc(OCc2ccccc2)c([C@@H]2C[C@H](CCc3ccc(OCc4ccccc4)cc3)O[C@H](c3ccc(OS(=O)(=O)c4ccccc4)cc3)C2)c(OC)c1Br |
| InChI | InChI=1S/C47H45BrO8S/c1-51-44-30-43(54-32-35-14-8-4-9-15-35)45(47(52-2)46(44)48)37-28-40(25-20-33-18-23-38(24-19-33)53-31-34-12-6-3-7-13-34)55-42(29-37)36-21-26-39(27-22-36)56-57(49,50)41-16-10-5-11-17-41/h3-19,21-24,26-27,30,37,40,42H,20,25,28-29,31-32H2,1-2H3/t37-,40+,42+/m1/s1 |
| InChIKey | MUZGFVNIKKDISD-BVZXGHIJSA-N |
| XLogP | 11.03 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 849.84 |
| LogP ≤ 5 | 11.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|