C10H18N4OS — CID 116510318
1-[1-(1H-imidazol-2-yl)ethyl]-3-(3-methoxypropyl)thiourea (PubChem CID 116510318) has the molecular formula C10H18N4OS and a molecular weight of 242.35 g/mol. Its IUPAC name is 1-[1-(1H-imidazol-2-yl)ethyl]-3-(3-methoxypropyl)thiourea.
| Compound Name | 1-[1-(1H-imidazol-2-yl)ethyl]-3-(3-methoxypropyl)thiourea |
|---|---|
| PubChem CID | 116510318 |
| Molecular Formula | C10H18N4OS |
| Molecular Weight | 242.35 g/mol |
| Exact Mass | 242.12 |
| IUPAC Name | 1-[1-(1H-imidazol-2-yl)ethyl]-3-(3-methoxypropyl)thiourea |
| SMILES | COCCCNC(=S)NC(C)c1ncc[nH]1 |
| InChI | InChI=1S/C10H18N4OS/c1-8(9-11-5-6-12-9)14-10(16)13-4-3-7-15-2/h5-6,8H,3-4,7H2,1-2H3,(H,11,12)(H2,13,14,16) |
| InChIKey | WTZPTFAOZXSCPJ-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 61.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.35 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|