C10H16N4O2 — CID 116510653
1-amino-3-(3,5-dimethoxyphenyl)-2-methylguanidine (PubChem CID 116510653) has the molecular formula C10H16N4O2 and a molecular weight of 224.26 g/mol. Its IUPAC name is 1-amino-3-(3,5-dimethoxyphenyl)-2-methylguanidine.
| Compound Name | 1-amino-3-(3,5-dimethoxyphenyl)-2-methylguanidine |
|---|---|
| PubChem CID | 116510653 |
| Molecular Formula | C10H16N4O2 |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.13 |
| IUPAC Name | 1-amino-3-(3,5-dimethoxyphenyl)-2-methylguanidine |
| SMILES | C/N=C(\NN)Nc1cc(OC)cc(OC)c1 |
| InChI | InChI=1S/C10H16N4O2/c1-12-10(14-11)13-7-4-8(15-2)6-9(5-7)16-3/h4-6H,11H2,1-3H3,(H2,12,13,14) |
| InChIKey | FMVMIQBHSKQQNP-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|