C8H16N6O — CID 116515833
1-amino-2-(2-methoxyethyl)-3-(1-methylpyrazol-3-yl)guanidine (PubChem CID 116515833) has the molecular formula C8H16N6O and a molecular weight of 212.26 g/mol. Its IUPAC name is 1-amino-2-(2-methoxyethyl)-3-(1-methylpyrazol-3-yl)guanidine.
| Compound Name | 1-amino-2-(2-methoxyethyl)-3-(1-methylpyrazol-3-yl)guanidine |
|---|---|
| PubChem CID | 116515833 |
| Molecular Formula | C8H16N6O |
| Molecular Weight | 212.26 g/mol |
| Exact Mass | 212.14 |
| IUPAC Name | 1-amino-2-(2-methoxyethyl)-3-(1-methylpyrazol-3-yl)guanidine |
| SMILES | COCC/N=C(\NN)Nc1ccn(C)n1 |
| InChI | InChI=1S/C8H16N6O/c1-14-5-3-7(13-14)11-8(12-9)10-4-6-15-2/h3,5H,4,6,9H2,1-2H3,(H2,10,11,12,13) |
| InChIKey | UXGVUHOEBRMQJZ-UHFFFAOYSA-N |
| XLogP | -0.70 |
| TPSA | 89.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.26 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|