C12H17F3N8O — CID 21279785
N'-cyano-3-[2-[3-[[N'-(2,2,2-trifluoroethyl)carbamimidoyl]amino]pyrazol-1-yl]ethoxy]propanimidamide (PubChem CID 21279785) has the molecular formula C12H17F3N8O and a molecular weight of 346.32 g/mol. Its IUPAC name is N'-cyano-3-[2-[3-[[N'-(2,2,2-trifluoroethyl)carbamimidoyl]amino]pyrazol-1-yl]ethoxy]propanimidamide.
| Compound Name | N'-cyano-3-[2-[3-[[N'-(2,2,2-trifluoroethyl)carbamimidoyl]amino]pyrazol-1-yl]ethoxy]propanimidamide |
|---|---|
| PubChem CID | 21279785 |
| Molecular Formula | C12H17F3N8O |
| Molecular Weight | 346.32 g/mol |
| Exact Mass | 346.15 |
| IUPAC Name | N'-cyano-3-[2-[3-[[N'-(2,2,2-trifluoroethyl)carbamimidoyl]amino]pyrazol-1-yl]ethoxy]propanimidamide |
| SMILES | N#C/N=C(\N)CCOCCn1ccc(N/C(N)=N/CC(F)(F)F)n1 |
| InChI | InChI=1S/C12H17F3N8O/c13-12(14,15)7-19-11(18)21-10-1-3-23(22-10)4-6-24-5-2-9(17)20-8-16/h1,3H,2,4-7H2,(H2,17,20)(H3,18,19,21,22) |
| InChIKey | NMEHOURFUMIYNV-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 139.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.32 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|