C8H12F3N5O — CID 21279848
1-[1-(2-hydroxyethyl)pyrazol-3-yl]-2-(2,2,2-trifluoroethyl)guanidine (PubChem CID 21279848) has the molecular formula C8H12F3N5O and a molecular weight of 251.21 g/mol. Its IUPAC name is 1-[1-(2-hydroxyethyl)pyrazol-3-yl]-2-(2,2,2-trifluoroethyl)guanidine.
| Compound Name | 1-[1-(2-hydroxyethyl)pyrazol-3-yl]-2-(2,2,2-trifluoroethyl)guanidine |
|---|---|
| PubChem CID | 21279848 |
| Molecular Formula | C8H12F3N5O |
| Molecular Weight | 251.21 g/mol |
| Exact Mass | 251.10 |
| IUPAC Name | 1-[1-(2-hydroxyethyl)pyrazol-3-yl]-2-(2,2,2-trifluoroethyl)guanidine |
| SMILES | N/C(=N\CC(F)(F)F)Nc1ccn(CCO)n1 |
| InChI | InChI=1S/C8H12F3N5O/c9-8(10,11)5-13-7(12)14-6-1-2-16(15-6)3-4-17/h1-2,17H,3-5H2,(H3,12,13,14,15) |
| InChIKey | LWEALJANYJSLPB-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 88.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.21 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|