C15H27NOSi — CID 11651868
(2S)-2-propyl-1-[2-(trimethylsilylmethyl)prop-2-enyl]-2,3-dihydropyridin-4-one (PubChem CID 11651868) has the molecular formula C15H27NOSi and a molecular weight of 265.47 g/mol. Its IUPAC name is (2S)-2-propyl-1-[2-(trimethylsilylmethyl)prop-2-enyl]-2,3-dihydropyridin-4-one.
| Compound Name | (2S)-2-propyl-1-[2-(trimethylsilylmethyl)prop-2-enyl]-2,3-dihydropyridin-4-one |
|---|---|
| PubChem CID | 11651868 |
| Molecular Formula | C15H27NOSi |
| Molecular Weight | 265.47 g/mol |
| Exact Mass | 265.19 |
| IUPAC Name | (2S)-2-propyl-1-[2-(trimethylsilylmethyl)prop-2-enyl]-2,3-dihydropyridin-4-one |
| SMILES | C=C(CN1C=CC(=O)C[C@@H]1CCC)C[Si](C)(C)C |
| InChI | InChI=1S/C15H27NOSi/c1-6-7-14-10-15(17)8-9-16(14)11-13(2)12-18(3,4)5/h8-9,14H,2,6-7,10-12H2,1,3-5H3/t14-/m0/s1 |
| InChIKey | WIHKKKXYHRZLSH-AWEZNQCLSA-N |
| XLogP | 3.84 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.47 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|