C23H21F4N5O3 — CID 1165239
(3-fluorophenyl)-[4-[(5R,7R)-5-(furan-2-yl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-2-carbonyl]piperazin-1-yl]methanone (PubChem CID 1165239) has the molecular formula C23H21F4N5O3 and a molecular weight of 491.45 g/mol. Its IUPAC name is (3-fluorophenyl)-[4-[(5R,7R)-5-(furan-2-yl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-2-carbonyl]piperazin-1-yl]methanone.
| Compound Name | (3-fluorophenyl)-[4-[(5R,7R)-5-(furan-2-yl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-2-carbonyl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 1165239 |
| Molecular Formula | C23H21F4N5O3 |
| Molecular Weight | 491.45 g/mol |
| Exact Mass | 491.16 |
| IUPAC Name | (3-fluorophenyl)-[4-[(5R,7R)-5-(furan-2-yl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-2-carbonyl]piperazin-1-yl]methanone |
| SMILES | O=C(c1cccc(F)c1)N1CCN(C(=O)c2cc3n(n2)[C@@H](C(F)(F)F)C[C@H](c2ccco2)N3)CC1 |
| InChI | InChI=1S/C23H21F4N5O3/c24-15-4-1-3-14(11-15)21(33)30-6-8-31(9-7-30)22(34)17-13-20-28-16(18-5-2-10-35-18)12-19(23(25,26)27)32(20)29-17/h1-5,10-11,13,16,19,28H,6-9,12H2/t16-,19-/m1/s1 |
| InChIKey | BBGLUGHYXFWXJS-VQIMIIECSA-N |
| XLogP | 3.87 |
| TPSA | 83.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.45 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |