C22H20F4N4O2 — CID 135652132
(6-fluoro-2-methyl-3,4-dihydro-2H-quinolin-1-yl)-[5-(furan-2-yl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-2-yl]methanone (PubChem CID 135652132) has the molecular formula C22H20F4N4O2 and a molecular weight of 448.42 g/mol. Its IUPAC name is (6-fluoro-2-methyl-3,4-dihydro-2H-quinolin-1-yl)-[5-(furan-2-yl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-2-yl]methanone.
| Compound Name | (6-fluoro-2-methyl-3,4-dihydro-2H-quinolin-1-yl)-[5-(furan-2-yl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-2-yl]methanone |
|---|---|
| PubChem CID | 135652132 |
| Molecular Formula | C22H20F4N4O2 |
| Molecular Weight | 448.42 g/mol |
| Exact Mass | 448.15 |
| IUPAC Name | (6-fluoro-2-methyl-3,4-dihydro-2H-quinolin-1-yl)-[5-(furan-2-yl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-2-yl]methanone |
| SMILES | CC1CCc2cc(F)ccc2N1C(=O)c1cc2n(n1)C(C(F)(F)F)CC(c1ccco1)N2 |
| InChI | InChI=1S/C22H20F4N4O2/c1-12-4-5-13-9-14(23)6-7-17(13)29(12)21(31)16-11-20-27-15(18-3-2-8-32-18)10-19(22(24,25)26)30(20)28-16/h2-3,6-9,11-12,15,19,27H,4-5,10H2,1H3 |
| InChIKey | XYAHVIMQWBBBKK-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 63.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.42 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |