C20H17F3N4O2 — CID 136762129
2,3-dihydroindol-1-yl-[(5S,7S)-5-(furan-2-yl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-2-yl]methanone (PubChem CID 136762129) has the molecular formula C20H17F3N4O2 and a molecular weight of 402.38 g/mol. Its IUPAC name is 2,3-dihydroindol-1-yl-[(5S,7S)-5-(furan-2-yl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-2-yl]methanone.
| Compound Name | 2,3-dihydroindol-1-yl-[(5S,7S)-5-(furan-2-yl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-2-yl]methanone |
|---|---|
| PubChem CID | 136762129 |
| Molecular Formula | C20H17F3N4O2 |
| Molecular Weight | 402.38 g/mol |
| Exact Mass | 402.13 |
| IUPAC Name | 2,3-dihydroindol-1-yl-[(5S,7S)-5-(furan-2-yl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-2-yl]methanone |
| SMILES | O=C(c1cc2n(n1)[C@H](C(F)(F)F)C[C@@H](c1ccco1)N2)N1CCc2ccccc21 |
| InChI | InChI=1S/C20H17F3N4O2/c21-20(22,23)17-10-13(16-6-3-9-29-16)24-18-11-14(25-27(17)18)19(28)26-8-7-12-4-1-2-5-15(12)26/h1-6,9,11,13,17,24H,7-8,10H2/t13-,17-/m0/s1 |
| InChIKey | CLYBSKQMNQCBRN-GUYCJALGSA-N |
| XLogP | 4.34 |
| TPSA | 63.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.38 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |