C16H17F3N4O2S — CID 1165287
[(5S,7R)-5-(furan-2-yl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-2-yl]-thiomorpholin-4-ylmethanone (PubChem CID 1165287) has the molecular formula C16H17F3N4O2S and a molecular weight of 386.40 g/mol. Its IUPAC name is [(5S,7R)-5-(furan-2-yl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-2-yl]-thiomorpholin-4-ylmethanone.
| Compound Name | [(5S,7R)-5-(furan-2-yl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-2-yl]-thiomorpholin-4-ylmethanone |
|---|---|
| PubChem CID | 1165287 |
| Molecular Formula | C16H17F3N4O2S |
| Molecular Weight | 386.40 g/mol |
| Exact Mass | 386.10 |
| IUPAC Name | [(5S,7R)-5-(furan-2-yl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-2-yl]-thiomorpholin-4-ylmethanone |
| SMILES | O=C(c1cc2n(n1)[C@@H](C(F)(F)F)C[C@@H](c1ccco1)N2)N1CCSCC1 |
| InChI | InChI=1S/C16H17F3N4O2S/c17-16(18,19)13-8-10(12-2-1-5-25-12)20-14-9-11(21-23(13)14)15(24)22-3-6-26-7-4-22/h1-2,5,9-10,13,20H,3-4,6-8H2/t10-,13+/m0/s1 |
| InChIKey | YBRJWQYMMSUMLW-GXFFZTMASA-N |
| XLogP | 3.33 |
| TPSA | 63.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.40 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |