C23H27F3N4O2 — CID 136736956
(5R,7R)-N-(1-adamantyl)-5-(furan-2-yl)-N-methyl-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-2-carboxamide (PubChem CID 136736956) has the molecular formula C23H27F3N4O2 and a molecular weight of 448.49 g/mol. Its IUPAC name is (5R,7R)-N-(1-adamantyl)-5-(furan-2-yl)-N-methyl-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-2-carboxamide.
| Compound Name | (5R,7R)-N-(1-adamantyl)-5-(furan-2-yl)-N-methyl-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-2-carboxamide |
|---|---|
| PubChem CID | 136736956 |
| Molecular Formula | C23H27F3N4O2 |
| Molecular Weight | 448.49 g/mol |
| Exact Mass | 448.21 |
| IUPAC Name | (5R,7R)-N-(1-adamantyl)-5-(furan-2-yl)-N-methyl-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-2-carboxamide |
| SMILES | CN(C(=O)c1cc2n(n1)[C@@H](C(F)(F)F)C[C@H](c1ccco1)N2)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C23H27F3N4O2/c1-29(22-10-13-5-14(11-22)7-15(6-13)12-22)21(31)17-9-20-27-16(18-3-2-4-32-18)8-19(23(24,25)26)30(20)28-17/h2-4,9,13-16,19,27H,5-8,10-12H2,1H3/t13?,14?,15?,16-,19-,22?/m1/s1 |
| InChIKey | NWCXUSQITRHCNT-NHDLTIKGSA-N |
| XLogP | 5.18 |
| TPSA | 63.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.49 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |