C13H12BrNO3 — CID 11652495
benzyl 5-bromo-4-oxo-2,3-dihydropyridine-1-carboxylate (PubChem CID 11652495) has the molecular formula C13H12BrNO3 and a molecular weight of 310.15 g/mol. Its IUPAC name is benzyl 5-bromo-4-oxo-2,3-dihydropyridine-1-carboxylate.
| Compound Name | benzyl 5-bromo-4-oxo-2,3-dihydropyridine-1-carboxylate |
|---|---|
| PubChem CID | 11652495 |
| Molecular Formula | C13H12BrNO3 |
| Molecular Weight | 310.15 g/mol |
| Exact Mass | 309.00 |
| IUPAC Name | benzyl 5-bromo-4-oxo-2,3-dihydropyridine-1-carboxylate |
| SMILES | O=C1CCN(C(=O)OCc2ccccc2)C=C1Br |
| InChI | InChI=1S/C13H12BrNO3/c14-11-8-15(7-6-12(11)16)13(17)18-9-10-4-2-1-3-5-10/h1-5,8H,6-7,9H2 |
| InChIKey | UEPVZNYZDVBQBD-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.15 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |