C15H11FN2O — CID 116532616
13-fluoro-6-methoxy-2,8-diazatetracyclo[7.7.0.02,7.010,15]hexadeca-1(9),3,5,7,10(15),11,13-heptaene (PubChem CID 116532616) has the molecular formula C15H11FN2O and a molecular weight of 254.26 g/mol. Its IUPAC name is 13-fluoro-6-methoxy-2,8-diazatetracyclo[7.7.0.02,7.010,15]hexadeca-1(9),3,5,7,10(15),11,13-heptaene.
| Compound Name | 13-fluoro-6-methoxy-2,8-diazatetracyclo[7.7.0.02,7.010,15]hexadeca-1(9),3,5,7,10(15),11,13-heptaene |
|---|---|
| PubChem CID | 116532616 |
| Molecular Formula | C15H11FN2O |
| Molecular Weight | 254.26 g/mol |
| Exact Mass | 254.09 |
| IUPAC Name | 13-fluoro-6-methoxy-2,8-diazatetracyclo[7.7.0.02,7.010,15]hexadeca-1(9),3,5,7,10(15),11,13-heptaene |
| SMILES | COc1cccn2c3c(nc12)-c1ccc(F)cc1C3 |
| InChI | InChI=1S/C15H11FN2O/c1-19-13-3-2-6-18-12-8-9-7-10(16)4-5-11(9)14(12)17-15(13)18/h2-7H,8H2,1H3 |
| InChIKey | ATPLLMAHUTWMHW-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 26.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.26 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |