C10H17F6N — CID 116536134
1,1,1,6,6,6-hexafluoro-2-methyl-N-propylhexan-2-amine (PubChem CID 116536134) has the molecular formula C10H17F6N and a molecular weight of 265.24 g/mol. Its IUPAC name is 1,1,1,6,6,6-hexafluoro-2-methyl-N-propylhexan-2-amine.
| Compound Name | 1,1,1,6,6,6-hexafluoro-2-methyl-N-propylhexan-2-amine |
|---|---|
| PubChem CID | 116536134 |
| Molecular Formula | C10H17F6N |
| Molecular Weight | 265.24 g/mol |
| Exact Mass | 265.13 |
| IUPAC Name | 1,1,1,6,6,6-hexafluoro-2-methyl-N-propylhexan-2-amine |
| SMILES | CCCNC(C)(CCCC(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C10H17F6N/c1-3-7-17-8(2,10(14,15)16)5-4-6-9(11,12)13/h17H,3-7H2,1-2H3 |
| InChIKey | DGJDICRDDDZXIU-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.24 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |