C15H20ClN — CID 116540409
8-(3-chloro-1-methylcyclopentyl)-5,6,7,8-tetrahydroquinoline (PubChem CID 116540409) has the molecular formula C15H20ClN and a molecular weight of 249.78 g/mol. Its IUPAC name is 8-(3-chloro-1-methylcyclopentyl)-5,6,7,8-tetrahydroquinoline.
| Compound Name | 8-(3-chloro-1-methylcyclopentyl)-5,6,7,8-tetrahydroquinoline |
|---|---|
| PubChem CID | 116540409 |
| Molecular Formula | C15H20ClN |
| Molecular Weight | 249.78 g/mol |
| Exact Mass | 249.13 |
| IUPAC Name | 8-(3-chloro-1-methylcyclopentyl)-5,6,7,8-tetrahydroquinoline |
| SMILES | CC1(C2CCCc3cccnc32)CCC(Cl)C1 |
| InChI | InChI=1S/C15H20ClN/c1-15(8-7-12(16)10-15)13-6-2-4-11-5-3-9-17-14(11)13/h3,5,9,12-13H,2,4,6-8,10H2,1H3 |
| InChIKey | TURPEVPRSLUIDX-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.78 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|