C14H17BrN4O2 — CID 116541331
1-[3-amino-5-bromo-2-[(2-propyl-1,2,4-triazol-3-yl)methoxy]phenyl]ethanone (PubChem CID 116541331) has the molecular formula C14H17BrN4O2 and a molecular weight of 353.22 g/mol. Its IUPAC name is 1-[3-amino-5-bromo-2-[(2-propyl-1,2,4-triazol-3-yl)methoxy]phenyl]ethanone.
| Compound Name | 1-[3-amino-5-bromo-2-[(2-propyl-1,2,4-triazol-3-yl)methoxy]phenyl]ethanone |
|---|---|
| PubChem CID | 116541331 |
| Molecular Formula | C14H17BrN4O2 |
| Molecular Weight | 353.22 g/mol |
| Exact Mass | 352.05 |
| IUPAC Name | 1-[3-amino-5-bromo-2-[(2-propyl-1,2,4-triazol-3-yl)methoxy]phenyl]ethanone |
| SMILES | CCCn1ncnc1COc1c(N)cc(Br)cc1C(C)=O |
| InChI | InChI=1S/C14H17BrN4O2/c1-3-4-19-13(17-8-18-19)7-21-14-11(9(2)20)5-10(15)6-12(14)16/h5-6,8H,3-4,7,16H2,1-2H3 |
| InChIKey | JSSOVOGAKVTFPZ-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.22 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|