C12H13NO — CID 116549750
1-(1,2,3,4-tetrahydroisoquinolin-3-yl)prop-2-en-1-one (PubChem CID 116549750) has the molecular formula C12H13NO and a molecular weight of 187.24 g/mol. Its IUPAC name is 1-(1,2,3,4-tetrahydroisoquinolin-3-yl)prop-2-en-1-one.
| Compound Name | 1-(1,2,3,4-tetrahydroisoquinolin-3-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 116549750 |
| Molecular Formula | C12H13NO |
| Molecular Weight | 187.24 g/mol |
| Exact Mass | 187.10 |
| IUPAC Name | 1-(1,2,3,4-tetrahydroisoquinolin-3-yl)prop-2-en-1-one |
| SMILES | C=CC(=O)C1Cc2ccccc2CN1 |
| InChI | InChI=1S/C12H13NO/c1-2-12(14)11-7-9-5-3-4-6-10(9)8-13-11/h2-6,11,13H,1,7-8H2 |
| InChIKey | BSCRYIVHFBCBGU-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.24 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|