C21H17BrN2O5 — CID 11655464
(3R,4R)-4-(5-bromo-1H-indol-3-yl)-3-nitro-3-(3-oxobutyl)-4H-chromen-2-one (PubChem CID 11655464) has the molecular formula C21H17BrN2O5 and a molecular weight of 457.28 g/mol. Its IUPAC name is (3R,4R)-4-(5-bromo-1H-indol-3-yl)-3-nitro-3-(3-oxobutyl)-4H-chromen-2-one.
| Compound Name | (3R,4R)-4-(5-bromo-1H-indol-3-yl)-3-nitro-3-(3-oxobutyl)-4H-chromen-2-one |
|---|---|
| PubChem CID | 11655464 |
| Molecular Formula | C21H17BrN2O5 |
| Molecular Weight | 457.28 g/mol |
| Exact Mass | 456.03 |
| IUPAC Name | (3R,4R)-4-(5-bromo-1H-indol-3-yl)-3-nitro-3-(3-oxobutyl)-4H-chromen-2-one |
| SMILES | CC(=O)CC[C@]1([N+](=O)[O-])C(=O)Oc2ccccc2[C@H]1c1c[nH]c2ccc(Br)cc12 |
| InChI | InChI=1S/C21H17BrN2O5/c1-12(25)8-9-21(24(27)28)19(14-4-2-3-5-18(14)29-20(21)26)16-11-23-17-7-6-13(22)10-15(16)17/h2-7,10-11,19,23H,8-9H2,1H3/t19-,21+/m0/s1 |
| InChIKey | GMAGZJKAFNOBHN-PZJWPPBQSA-N |
| XLogP | 4.37 |
| TPSA | 102.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.28 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|