C23H20BrNO2 — CID 134842574
6-bromo-9-(1H-indol-3-yl)-3,3-dimethyl-4,9-dihydro-2H-xanthen-1-one (PubChem CID 134842574) has the molecular formula C23H20BrNO2 and a molecular weight of 422.32 g/mol. Its IUPAC name is 6-bromo-9-(1H-indol-3-yl)-3,3-dimethyl-4,9-dihydro-2H-xanthen-1-one.
| Compound Name | 6-bromo-9-(1H-indol-3-yl)-3,3-dimethyl-4,9-dihydro-2H-xanthen-1-one |
|---|---|
| PubChem CID | 134842574 |
| Molecular Formula | C23H20BrNO2 |
| Molecular Weight | 422.32 g/mol |
| Exact Mass | 421.07 |
| IUPAC Name | 6-bromo-9-(1H-indol-3-yl)-3,3-dimethyl-4,9-dihydro-2H-xanthen-1-one |
| SMILES | CC1(C)CC(=O)C2=C(C1)Oc1cc(Br)ccc1C2c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C23H20BrNO2/c1-23(2)10-18(26)22-20(11-23)27-19-9-13(24)7-8-15(19)21(22)16-12-25-17-6-4-3-5-14(16)17/h3-9,12,21,25H,10-11H2,1-2H3 |
| InChIKey | AEBZHWYEJFWVKZ-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.32 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |