C22H20Cl2F3NO3 — CID 11655837
(E)-4-(3,3-dichloroprop-2-enoxy)-N-[3-[3-(trifluoromethyl)phenoxy]propoxy]-2,3-dihydroinden-1-imine (PubChem CID 11655837) has the molecular formula C22H20Cl2F3NO3 and a molecular weight of 474.31 g/mol. Its IUPAC name is (E)-4-(3,3-dichloroprop-2-enoxy)-N-[3-[3-(trifluoromethyl)phenoxy]propoxy]-2,3-dihydroinden-1-imine.
| Compound Name | (E)-4-(3,3-dichloroprop-2-enoxy)-N-[3-[3-(trifluoromethyl)phenoxy]propoxy]-2,3-dihydroinden-1-imine |
|---|---|
| PubChem CID | 11655837 |
| Molecular Formula | C22H20Cl2F3NO3 |
| Molecular Weight | 474.31 g/mol |
| Exact Mass | 473.08 |
| IUPAC Name | (E)-4-(3,3-dichloroprop-2-enoxy)-N-[3-[3-(trifluoromethyl)phenoxy]propoxy]-2,3-dihydroinden-1-imine |
| SMILES | FC(F)(F)c1cccc(OCCCO/N=C2\CCc3c(OCC=C(Cl)Cl)cccc32)c1 |
| InChI | InChI=1S/C22H20Cl2F3NO3/c23-21(24)10-13-30-20-7-2-6-17-18(20)8-9-19(17)28-31-12-3-11-29-16-5-1-4-15(14-16)22(25,26)27/h1-2,4-7,10,14H,3,8-9,11-13H2/b28-19+ |
| InChIKey | VQXCNAUWIRGCJN-TURZUDJPSA-N |
| XLogP | 6.54 |
| TPSA | 40.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.31 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|