C22H21Cl3N2O4 — CID 11698726
2-[(E)-[5-(3,3-dichloroprop-2-enoxy)-3,4-dihydro-2H-naphthalen-1-ylidene]amino]oxyethyl N-(2-chlorophenyl)carbamate (PubChem CID 11698726) has the molecular formula C22H21Cl3N2O4 and a molecular weight of 483.78 g/mol. Its IUPAC name is 2-[(E)-[5-(3,3-dichloroprop-2-enoxy)-3,4-dihydro-2H-naphthalen-1-ylidene]amino]oxyethyl N-(2-chlorophenyl)carbamate.
| Compound Name | 2-[(E)-[5-(3,3-dichloroprop-2-enoxy)-3,4-dihydro-2H-naphthalen-1-ylidene]amino]oxyethyl N-(2-chlorophenyl)carbamate |
|---|---|
| PubChem CID | 11698726 |
| Molecular Formula | C22H21Cl3N2O4 |
| Molecular Weight | 483.78 g/mol |
| Exact Mass | 482.06 |
| IUPAC Name | 2-[(E)-[5-(3,3-dichloroprop-2-enoxy)-3,4-dihydro-2H-naphthalen-1-ylidene]amino]oxyethyl N-(2-chlorophenyl)carbamate |
| SMILES | O=C(Nc1ccccc1Cl)OCCO/N=C1\CCCc2c(OCC=C(Cl)Cl)cccc21 |
| InChI | InChI=1S/C22H21Cl3N2O4/c23-17-7-1-2-8-19(17)26-22(28)30-13-14-31-27-18-9-3-6-16-15(18)5-4-10-20(16)29-12-11-21(24)25/h1-2,4-5,7-8,10-11H,3,6,9,12-14H2,(H,26,28)/b27-18+ |
| InChIKey | MEGVSRFCAWJXNS-OVVQPSECSA-N |
| XLogP | 6.34 |
| TPSA | 69.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.78 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|