C22H23ClN2O2 — CID 3338717
propyl N-[2-[[2-[(4-chlorophenyl)methylidene]cyclopentylidene]amino]phenyl]carbamate (PubChem CID 3338717) has the molecular formula C22H23ClN2O2 and a molecular weight of 382.89 g/mol. Its IUPAC name is propyl N-[2-[[2-[(4-chlorophenyl)methylidene]cyclopentylidene]amino]phenyl]carbamate.
| Compound Name | propyl N-[2-[[2-[(4-chlorophenyl)methylidene]cyclopentylidene]amino]phenyl]carbamate |
|---|---|
| PubChem CID | 3338717 |
| Molecular Formula | C22H23ClN2O2 |
| Molecular Weight | 382.89 g/mol |
| Exact Mass | 382.14 |
| IUPAC Name | propyl N-[2-[[2-[(4-chlorophenyl)methylidene]cyclopentylidene]amino]phenyl]carbamate |
| SMILES | CCCOC(=O)Nc1ccccc1/N=C1\CCCC1=Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H23ClN2O2/c1-2-14-27-22(26)25-21-8-4-3-7-20(21)24-19-9-5-6-17(19)15-16-10-12-18(23)13-11-16/h3-4,7-8,10-13,15H,2,5-6,9,14H2,1H3,(H,25,26)/b17-15?,24-19+ |
| InChIKey | XWQOGTZBSYDUHU-KEOIFMLRSA-N |
| XLogP | 6.64 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.89 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|