C24H20Cl2O3 — CID 11004453
ethyl 2-[(3E,5E)-3,5-bis[(4-chlorophenyl)methylidene]-4-oxocyclohexylidene]acetate (PubChem CID 11004453) has the molecular formula C24H20Cl2O3 and a molecular weight of 427.33 g/mol. Its IUPAC name is ethyl 2-[(3E,5E)-3,5-bis[(4-chlorophenyl)methylidene]-4-oxocyclohexylidene]acetate.
| Compound Name | ethyl 2-[(3E,5E)-3,5-bis[(4-chlorophenyl)methylidene]-4-oxocyclohexylidene]acetate |
|---|---|
| PubChem CID | 11004453 |
| Molecular Formula | C24H20Cl2O3 |
| Molecular Weight | 427.33 g/mol |
| Exact Mass | 426.08 |
| IUPAC Name | ethyl 2-[(3E,5E)-3,5-bis[(4-chlorophenyl)methylidene]-4-oxocyclohexylidene]acetate |
| SMILES | CCOC(=O)C=C1C/C(=C\c2ccc(Cl)cc2)C(=O)/C(=C/c2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C24H20Cl2O3/c1-2-29-23(27)15-18-13-19(11-16-3-7-21(25)8-4-16)24(28)20(14-18)12-17-5-9-22(26)10-6-17/h3-12,15H,2,13-14H2,1H3/b19-11+,20-12+ |
| InChIKey | VCSFVVGYXNEQAL-AYKLPDECSA-N |
| XLogP | 6.31 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.33 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|