C21H17Cl2F3N2O — CID 87967546
(E)-5-(3,3-dichloroprop-2-enoxy)-N-[(E)-[4-(trifluoromethyl)phenyl]methylideneamino]-3,4-dihydro-2H-naphthalen-1-imine (PubChem CID 87967546) has the molecular formula C21H17Cl2F3N2O and a molecular weight of 441.28 g/mol. Its IUPAC name is (E)-5-(3,3-dichloroprop-2-enoxy)-N-[(E)-[4-(trifluoromethyl)phenyl]methylideneamino]-3,4-dihydro-2H-naphthalen-1-imine.
| Compound Name | (E)-5-(3,3-dichloroprop-2-enoxy)-N-[(E)-[4-(trifluoromethyl)phenyl]methylideneamino]-3,4-dihydro-2H-naphthalen-1-imine |
|---|---|
| PubChem CID | 87967546 |
| Molecular Formula | C21H17Cl2F3N2O |
| Molecular Weight | 441.28 g/mol |
| Exact Mass | 440.07 |
| IUPAC Name | (E)-5-(3,3-dichloroprop-2-enoxy)-N-[(E)-[4-(trifluoromethyl)phenyl]methylideneamino]-3,4-dihydro-2H-naphthalen-1-imine |
| SMILES | FC(F)(F)c1ccc(/C=N/N=C2/CCCc3c(OCC=C(Cl)Cl)cccc32)cc1 |
| InChI | InChI=1S/C21H17Cl2F3N2O/c22-20(23)11-12-29-19-6-2-3-16-17(19)4-1-5-18(16)28-27-13-14-7-9-15(10-8-14)21(24,25)26/h2-3,6-11,13H,1,4-5,12H2/b27-13+,28-18- |
| InChIKey | REAXNRIJMMQKOE-KWWUCCLCSA-N |
| XLogP | 6.56 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.28 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|