C11H17N3OS — CID 116565556
1-(1,4-diazepan-1-yl)-3-(1,3-thiazol-5-yl)propan-2-one (PubChem CID 116565556) has the molecular formula C11H17N3OS and a molecular weight of 239.34 g/mol. Its IUPAC name is 1-(1,4-diazepan-1-yl)-3-(1,3-thiazol-5-yl)propan-2-one.
| Compound Name | 1-(1,4-diazepan-1-yl)-3-(1,3-thiazol-5-yl)propan-2-one |
|---|---|
| PubChem CID | 116565556 |
| Molecular Formula | C11H17N3OS |
| Molecular Weight | 239.34 g/mol |
| Exact Mass | 239.11 |
| IUPAC Name | 1-(1,4-diazepan-1-yl)-3-(1,3-thiazol-5-yl)propan-2-one |
| SMILES | O=C(Cc1cncs1)CN1CCCNCC1 |
| InChI | InChI=1S/C11H17N3OS/c15-10(6-11-7-13-9-16-11)8-14-4-1-2-12-3-5-14/h7,9,12H,1-6,8H2 |
| InChIKey | FOHTXVGURAHMPG-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.34 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |