About 1-aminodec-9-yn-5-one
1-aminodec-9-yn-5-one (PubChem CID 116571970) has the molecular formula C10H17NO
and a molecular weight of 167.25 g/mol. Its IUPAC name is 1-aminodec-9-yn-5-one.
Molecular Properties
| Compound Name | 1-aminodec-9-yn-5-one |
| PubChem CID | 116571970 |
| Molecular Formula | C10H17NO |
| Molecular Weight | 167.25 g/mol |
| Exact Mass | 167.13 |
| IUPAC Name | 1-aminodec-9-yn-5-one |
| SMILES | C#CCCCC(=O)CCCCN |
| InChI | InChI=1S/C10H17NO/c1-2-3-4-7-10(12)8-5-6-9-11/h1H,3-9,11H2 |
| InChIKey | SFPSHLYMYJGHFU-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.25 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-aminodec-9-yn-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-aminodec-9-yn-5-one?
The IUPAC name of 1-aminodec-9-yn-5-one (CID 116571970) is 1-aminodec-9-yn-5-one.
What is the SMILES notation for 1-aminodec-9-yn-5-one?
The canonical SMILES for 1-aminodec-9-yn-5-one is C#CCCCC(=O)CCCCN.
What is the InChIKey of 1-aminodec-9-yn-5-one?
The InChIKey is SFPSHLYMYJGHFU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17NO/c1-2-3-4-7-10(12)8-5-6-9-11/h1H,3-9,11H2.
What are the key properties of 1-aminodec-9-yn-5-one?
1-aminodec-9-yn-5-one has a molecular weight of 167.25 g/mol, XLogP of 1.49, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-aminodec-9-yn-5-one is sourced from PubChem (CID 116571970), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).