C11H19NO3S — CID 116595616
1-(1,1-dioxo-1,4-thiazinan-3-yl)-4-methylidenehexan-2-one (PubChem CID 116595616) has the molecular formula C11H19NO3S and a molecular weight of 245.34 g/mol. Its IUPAC name is 1-(1,1-dioxo-1,4-thiazinan-3-yl)-4-methylidenehexan-2-one.
| Compound Name | 1-(1,1-dioxo-1,4-thiazinan-3-yl)-4-methylidenehexan-2-one |
|---|---|
| PubChem CID | 116595616 |
| Molecular Formula | C11H19NO3S |
| Molecular Weight | 245.34 g/mol |
| Exact Mass | 245.11 |
| IUPAC Name | 1-(1,1-dioxo-1,4-thiazinan-3-yl)-4-methylidenehexan-2-one |
| SMILES | C=C(CC)CC(=O)CC1CS(=O)(=O)CCN1 |
| InChI | InChI=1S/C11H19NO3S/c1-3-9(2)6-11(13)7-10-8-16(14,15)5-4-12-10/h10,12H,2-8H2,1H3 |
| InChIKey | NBMKMMXCGFCKSO-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.34 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|