C20H18N4OS — CID 11660540
13-(cyclopropylamino)-5-(4-ethylphenyl)-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,9,11-pentaen-6-one (PubChem CID 11660540) has the molecular formula C20H18N4OS and a molecular weight of 362.46 g/mol. Its IUPAC name is 13-(cyclopropylamino)-5-(4-ethylphenyl)-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,9,11-pentaen-6-one.
| Compound Name | 13-(cyclopropylamino)-5-(4-ethylphenyl)-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,9,11-pentaen-6-one |
|---|---|
| PubChem CID | 11660540 |
| Molecular Formula | C20H18N4OS |
| Molecular Weight | 362.46 g/mol |
| Exact Mass | 362.12 |
| IUPAC Name | 13-(cyclopropylamino)-5-(4-ethylphenyl)-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,9,11-pentaen-6-one |
| SMILES | CCc1ccc(-n2cnc3c(sc4nccc(NC5CC5)c43)c2=O)cc1 |
| InChI | InChI=1S/C20H18N4OS/c1-2-12-3-7-14(8-4-12)24-11-22-17-16-15(23-13-5-6-13)9-10-21-19(16)26-18(17)20(24)25/h3-4,7-11,13H,2,5-6H2,1H3,(H,21,23) |
| InChIKey | KZZRMKCDXGJHJT-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.46 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |